C24H33N3OS — CID 16994788
N-[5-(1-heptylbenzimidazol-2-yl)pentyl]thiophene-2-carboxamide (PubChem CID 16994788) has the molecular formula C24H33N3OS and a molecular weight of 411.62 g/mol. Its IUPAC name is N-[5-(1-heptylbenzimidazol-2-yl)pentyl]thiophene-2-carboxamide.
| Compound Name | N-[5-(1-heptylbenzimidazol-2-yl)pentyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 16994788 |
| Molecular Formula | C24H33N3OS |
| Molecular Weight | 411.62 g/mol |
| Exact Mass | 411.23 |
| IUPAC Name | N-[5-(1-heptylbenzimidazol-2-yl)pentyl]thiophene-2-carboxamide |
| SMILES | CCCCCCCn1c(CCCCCNC(=O)c2cccs2)nc2ccccc21 |
| InChI | InChI=1S/C24H33N3OS/c1-2-3-4-5-11-18-27-21-14-9-8-13-20(21)26-23(27)16-7-6-10-17-25-24(28)22-15-12-19-29-22/h8-9,12-15,19H,2-7,10-11,16-18H2,1H3,(H,25,28) |
| InChIKey | PRIJQBVJIJQLBY-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.62 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|