C27H31N3O2S — CID 16994844
N-[5-[1-[2-(4-ethylphenoxy)ethyl]benzimidazol-2-yl]pentyl]thiophene-2-carboxamide (PubChem CID 16994844) has the molecular formula C27H31N3O2S and a molecular weight of 461.63 g/mol. Its IUPAC name is N-[5-[1-[2-(4-ethylphenoxy)ethyl]benzimidazol-2-yl]pentyl]thiophene-2-carboxamide.
| Compound Name | N-[5-[1-[2-(4-ethylphenoxy)ethyl]benzimidazol-2-yl]pentyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 16994844 |
| Molecular Formula | C27H31N3O2S |
| Molecular Weight | 461.63 g/mol |
| Exact Mass | 461.21 |
| IUPAC Name | N-[5-[1-[2-(4-ethylphenoxy)ethyl]benzimidazol-2-yl]pentyl]thiophene-2-carboxamide |
| SMILES | CCc1ccc(OCCn2c(CCCCCNC(=O)c3cccs3)nc3ccccc32)cc1 |
| InChI | InChI=1S/C27H31N3O2S/c1-2-21-13-15-22(16-14-21)32-19-18-30-24-10-6-5-9-23(24)29-26(30)12-4-3-7-17-28-27(31)25-11-8-20-33-25/h5-6,8-11,13-16,20H,2-4,7,12,17-19H2,1H3,(H,28,31) |
| InChIKey | SQRNLDVTAHFDBA-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.63 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|