C32H39N3O5 — CID 16991118
N-[5-[1-[2-(4-ethylphenoxy)ethyl]benzimidazol-2-yl]pentyl]-3,4,5-trimethoxybenzamide (PubChem CID 16991118) has the molecular formula C32H39N3O5 and a molecular weight of 545.68 g/mol. Its IUPAC name is N-[5-[1-[2-(4-ethylphenoxy)ethyl]benzimidazol-2-yl]pentyl]-3,4,5-trimethoxybenzamide.
| Compound Name | N-[5-[1-[2-(4-ethylphenoxy)ethyl]benzimidazol-2-yl]pentyl]-3,4,5-trimethoxybenzamide |
|---|---|
| PubChem CID | 16991118 |
| Molecular Formula | C32H39N3O5 |
| Molecular Weight | 545.68 g/mol |
| Exact Mass | 545.29 |
| IUPAC Name | N-[5-[1-[2-(4-ethylphenoxy)ethyl]benzimidazol-2-yl]pentyl]-3,4,5-trimethoxybenzamide |
| SMILES | CCc1ccc(OCCn2c(CCCCCNC(=O)c3cc(OC)c(OC)c(OC)c3)nc3ccccc32)cc1 |
| InChI | InChI=1S/C32H39N3O5/c1-5-23-14-16-25(17-15-23)40-20-19-35-27-12-9-8-11-26(27)34-30(35)13-7-6-10-18-33-32(36)24-21-28(37-2)31(39-4)29(22-24)38-3/h8-9,11-12,14-17,21-22H,5-7,10,13,18-20H2,1-4H3,(H,33,36) |
| InChIKey | ADQVYFZBJOMZEH-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 83.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.68 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|