C31H37N3O5 — CID 16991125
3,4,5-trimethoxy-N-[5-[1-(3-phenoxypropyl)benzimidazol-2-yl]pentyl]benzamide (PubChem CID 16991125) has the molecular formula C31H37N3O5 and a molecular weight of 531.65 g/mol. Its IUPAC name is 3,4,5-trimethoxy-N-[5-[1-(3-phenoxypropyl)benzimidazol-2-yl]pentyl]benzamide.
| Compound Name | 3,4,5-trimethoxy-N-[5-[1-(3-phenoxypropyl)benzimidazol-2-yl]pentyl]benzamide |
|---|---|
| PubChem CID | 16991125 |
| Molecular Formula | C31H37N3O5 |
| Molecular Weight | 531.65 g/mol |
| Exact Mass | 531.27 |
| IUPAC Name | 3,4,5-trimethoxy-N-[5-[1-(3-phenoxypropyl)benzimidazol-2-yl]pentyl]benzamide |
| SMILES | COc1cc(C(=O)NCCCCCc2nc3ccccc3n2CCCOc2ccccc2)cc(OC)c1OC |
| InChI | InChI=1S/C31H37N3O5/c1-36-27-21-23(22-28(37-2)30(27)38-3)31(35)32-18-11-5-8-17-29-33-25-15-9-10-16-26(25)34(29)19-12-20-39-24-13-6-4-7-14-24/h4,6-7,9-10,13-16,21-22H,5,8,11-12,17-20H2,1-3H3,(H,32,35) |
| InChIKey | XKAMYJWBXJDUPH-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 83.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.65 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|