C33H41N3O5 — CID 16977095
N-[2-[1-[4-(4-tert-butylphenoxy)butyl]benzimidazol-2-yl]ethyl]-3,4,5-trimethoxybenzamide (PubChem CID 16977095) has the molecular formula C33H41N3O5 and a molecular weight of 559.71 g/mol. Its IUPAC name is N-[2-[1-[4-(4-tert-butylphenoxy)butyl]benzimidazol-2-yl]ethyl]-3,4,5-trimethoxybenzamide.
| Compound Name | N-[2-[1-[4-(4-tert-butylphenoxy)butyl]benzimidazol-2-yl]ethyl]-3,4,5-trimethoxybenzamide |
|---|---|
| PubChem CID | 16977095 |
| Molecular Formula | C33H41N3O5 |
| Molecular Weight | 559.71 g/mol |
| Exact Mass | 559.30 |
| IUPAC Name | N-[2-[1-[4-(4-tert-butylphenoxy)butyl]benzimidazol-2-yl]ethyl]-3,4,5-trimethoxybenzamide |
| SMILES | COc1cc(C(=O)NCCc2nc3ccccc3n2CCCCOc2ccc(C(C)(C)C)cc2)cc(OC)c1OC |
| InChI | InChI=1S/C33H41N3O5/c1-33(2,3)24-13-15-25(16-14-24)41-20-10-9-19-36-27-12-8-7-11-26(27)35-30(36)17-18-34-32(37)23-21-28(38-4)31(40-6)29(22-23)39-5/h7-8,11-16,21-22H,9-10,17-20H2,1-6H3,(H,34,37) |
| InChIKey | IWKOLVZLRIQNEB-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 83.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.71 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|