C30H35N3O5 — CID 16977064
N-[2-[1-[3-(3,4-dimethylphenoxy)propyl]benzimidazol-2-yl]ethyl]-3,4,5-trimethoxybenzamide (PubChem CID 16977064) has the molecular formula C30H35N3O5 and a molecular weight of 517.63 g/mol. Its IUPAC name is N-[2-[1-[3-(3,4-dimethylphenoxy)propyl]benzimidazol-2-yl]ethyl]-3,4,5-trimethoxybenzamide.
| Compound Name | N-[2-[1-[3-(3,4-dimethylphenoxy)propyl]benzimidazol-2-yl]ethyl]-3,4,5-trimethoxybenzamide |
|---|---|
| PubChem CID | 16977064 |
| Molecular Formula | C30H35N3O5 |
| Molecular Weight | 517.63 g/mol |
| Exact Mass | 517.26 |
| IUPAC Name | N-[2-[1-[3-(3,4-dimethylphenoxy)propyl]benzimidazol-2-yl]ethyl]-3,4,5-trimethoxybenzamide |
| SMILES | COc1cc(C(=O)NCCc2nc3ccccc3n2CCCOc2ccc(C)c(C)c2)cc(OC)c1OC |
| InChI | InChI=1S/C30H35N3O5/c1-20-11-12-23(17-21(20)2)38-16-8-15-33-25-10-7-6-9-24(25)32-28(33)13-14-31-30(34)22-18-26(35-3)29(37-5)27(19-22)36-4/h6-7,9-12,17-19H,8,13-16H2,1-5H3,(H,31,34) |
| InChIKey | HAYOXMGMPFVRBY-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 83.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.63 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|