C31H37N3O5 — CID 16977075
N-[2-[1-[4-(2,3-dimethylphenoxy)butyl]benzimidazol-2-yl]ethyl]-3,4,5-trimethoxybenzamide (PubChem CID 16977075) has the molecular formula C31H37N3O5 and a molecular weight of 531.65 g/mol. Its IUPAC name is N-[2-[1-[4-(2,3-dimethylphenoxy)butyl]benzimidazol-2-yl]ethyl]-3,4,5-trimethoxybenzamide.
| Compound Name | N-[2-[1-[4-(2,3-dimethylphenoxy)butyl]benzimidazol-2-yl]ethyl]-3,4,5-trimethoxybenzamide |
|---|---|
| PubChem CID | 16977075 |
| Molecular Formula | C31H37N3O5 |
| Molecular Weight | 531.65 g/mol |
| Exact Mass | 531.27 |
| IUPAC Name | N-[2-[1-[4-(2,3-dimethylphenoxy)butyl]benzimidazol-2-yl]ethyl]-3,4,5-trimethoxybenzamide |
| SMILES | COc1cc(C(=O)NCCc2nc3ccccc3n2CCCCOc2cccc(C)c2C)cc(OC)c1OC |
| InChI | InChI=1S/C31H37N3O5/c1-21-11-10-14-26(22(21)2)39-18-9-8-17-34-25-13-7-6-12-24(25)33-29(34)15-16-32-31(35)23-19-27(36-3)30(38-5)28(20-23)37-4/h6-7,10-14,19-20H,8-9,15-18H2,1-5H3,(H,32,35) |
| InChIKey | AJCMXLQSCLUIBH-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 83.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.65 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|