C33H41N3O5 — CID 16977079
3,4,5-trimethoxy-N-[2-[1-[4-(5-methyl-2-propan-2-ylphenoxy)butyl]benzimidazol-2-yl]ethyl]benzamide (PubChem CID 16977079) has the molecular formula C33H41N3O5 and a molecular weight of 559.71 g/mol. Its IUPAC name is 3,4,5-trimethoxy-N-[2-[1-[4-(5-methyl-2-propan-2-ylphenoxy)butyl]benzimidazol-2-yl]ethyl]benzamide.
| Compound Name | 3,4,5-trimethoxy-N-[2-[1-[4-(5-methyl-2-propan-2-ylphenoxy)butyl]benzimidazol-2-yl]ethyl]benzamide |
|---|---|
| PubChem CID | 16977079 |
| Molecular Formula | C33H41N3O5 |
| Molecular Weight | 559.71 g/mol |
| Exact Mass | 559.30 |
| IUPAC Name | 3,4,5-trimethoxy-N-[2-[1-[4-(5-methyl-2-propan-2-ylphenoxy)butyl]benzimidazol-2-yl]ethyl]benzamide |
| SMILES | COc1cc(C(=O)NCCc2nc3ccccc3n2CCCCOc2cc(C)ccc2C(C)C)cc(OC)c1OC |
| InChI | InChI=1S/C33H41N3O5/c1-22(2)25-14-13-23(3)19-28(25)41-18-10-9-17-36-27-12-8-7-11-26(27)35-31(36)15-16-34-33(37)24-20-29(38-4)32(40-6)30(21-24)39-5/h7-8,11-14,19-22H,9-10,15-18H2,1-6H3,(H,34,37) |
| InChIKey | ZZHAVFQWQXLAKJ-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 83.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.71 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|