C26H28N4O2 — CID 16966412
N-[2-[1-[3-(2,3-dimethylphenoxy)propyl]benzimidazol-2-yl]ethyl]pyridine-2-carboxamide (PubChem CID 16966412) has the molecular formula C26H28N4O2 and a molecular weight of 428.54 g/mol. Its IUPAC name is N-[2-[1-[3-(2,3-dimethylphenoxy)propyl]benzimidazol-2-yl]ethyl]pyridine-2-carboxamide.
| Compound Name | N-[2-[1-[3-(2,3-dimethylphenoxy)propyl]benzimidazol-2-yl]ethyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 16966412 |
| Molecular Formula | C26H28N4O2 |
| Molecular Weight | 428.54 g/mol |
| Exact Mass | 428.22 |
| IUPAC Name | N-[2-[1-[3-(2,3-dimethylphenoxy)propyl]benzimidazol-2-yl]ethyl]pyridine-2-carboxamide |
| SMILES | Cc1cccc(OCCCn2c(CCNC(=O)c3ccccn3)nc3ccccc32)c1C |
| InChI | InChI=1S/C26H28N4O2/c1-19-9-7-13-24(20(19)2)32-18-8-17-30-23-12-4-3-10-21(23)29-25(30)14-16-28-26(31)22-11-5-6-15-27-22/h3-7,9-13,15H,8,14,16-18H2,1-2H3,(H,28,31) |
| InChIKey | BVRMIJBDFYKHHM-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.54 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|