C27H35N3O2 — CID 16975083
N-[2-[1-[3-(2,3-dimethylphenoxy)propyl]benzimidazol-2-yl]ethyl]cyclohexanecarboxamide (PubChem CID 16975083) has the molecular formula C27H35N3O2 and a molecular weight of 433.60 g/mol. Its IUPAC name is N-[2-[1-[3-(2,3-dimethylphenoxy)propyl]benzimidazol-2-yl]ethyl]cyclohexanecarboxamide.
| Compound Name | N-[2-[1-[3-(2,3-dimethylphenoxy)propyl]benzimidazol-2-yl]ethyl]cyclohexanecarboxamide |
|---|---|
| PubChem CID | 16975083 |
| Molecular Formula | C27H35N3O2 |
| Molecular Weight | 433.60 g/mol |
| Exact Mass | 433.27 |
| IUPAC Name | N-[2-[1-[3-(2,3-dimethylphenoxy)propyl]benzimidazol-2-yl]ethyl]cyclohexanecarboxamide |
| SMILES | Cc1cccc(OCCCn2c(CCNC(=O)C3CCCCC3)nc3ccccc32)c1C |
| InChI | InChI=1S/C27H35N3O2/c1-20-10-8-15-25(21(20)2)32-19-9-18-30-24-14-7-6-13-23(24)29-26(30)16-17-28-27(31)22-11-4-3-5-12-22/h6-8,10,13-15,22H,3-5,9,11-12,16-19H2,1-2H3,(H,28,31) |
| InChIKey | UYVBNUQALVQIEF-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.60 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|