C28H37N3O2 — CID 18888801
N-[2-[1-[4-(3,5-dimethylphenoxy)butyl]benzimidazol-2-yl]ethyl]cyclohexanecarboxamide (PubChem CID 18888801) has the molecular formula C28H37N3O2 and a molecular weight of 447.62 g/mol. Its IUPAC name is N-[2-[1-[4-(3,5-dimethylphenoxy)butyl]benzimidazol-2-yl]ethyl]cyclohexanecarboxamide.
| Compound Name | N-[2-[1-[4-(3,5-dimethylphenoxy)butyl]benzimidazol-2-yl]ethyl]cyclohexanecarboxamide |
|---|---|
| PubChem CID | 18888801 |
| Molecular Formula | C28H37N3O2 |
| Molecular Weight | 447.62 g/mol |
| Exact Mass | 447.29 |
| IUPAC Name | N-[2-[1-[4-(3,5-dimethylphenoxy)butyl]benzimidazol-2-yl]ethyl]cyclohexanecarboxamide |
| SMILES | Cc1cc(C)cc(OCCCCn2c(CCNC(=O)C3CCCCC3)nc3ccccc32)c1 |
| InChI | InChI=1S/C28H37N3O2/c1-21-18-22(2)20-24(19-21)33-17-9-8-16-31-26-13-7-6-12-25(26)30-27(31)14-15-29-28(32)23-10-4-3-5-11-23/h6-7,12-13,18-20,23H,3-5,8-11,14-17H2,1-2H3,(H,29,32) |
| InChIKey | DFJSOBIHFAAQQG-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.62 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|