C29H33N3O2 — CID 16976624
N-[2-[1-[4-(3,5-dimethylphenoxy)butyl]benzimidazol-2-yl]ethyl]-4-methylbenzamide (PubChem CID 16976624) has the molecular formula C29H33N3O2 and a molecular weight of 455.60 g/mol. Its IUPAC name is N-[2-[1-[4-(3,5-dimethylphenoxy)butyl]benzimidazol-2-yl]ethyl]-4-methylbenzamide.
| Compound Name | N-[2-[1-[4-(3,5-dimethylphenoxy)butyl]benzimidazol-2-yl]ethyl]-4-methylbenzamide |
|---|---|
| PubChem CID | 16976624 |
| Molecular Formula | C29H33N3O2 |
| Molecular Weight | 455.60 g/mol |
| Exact Mass | 455.26 |
| IUPAC Name | N-[2-[1-[4-(3,5-dimethylphenoxy)butyl]benzimidazol-2-yl]ethyl]-4-methylbenzamide |
| SMILES | Cc1ccc(C(=O)NCCc2nc3ccccc3n2CCCCOc2cc(C)cc(C)c2)cc1 |
| InChI | InChI=1S/C29H33N3O2/c1-21-10-12-24(13-11-21)29(33)30-15-14-28-31-26-8-4-5-9-27(26)32(28)16-6-7-17-34-25-19-22(2)18-23(3)20-25/h4-5,8-13,18-20H,6-7,14-17H2,1-3H3,(H,30,33) |
| InChIKey | MFNFDKNPIQNYRE-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.60 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|