C35H37N3O2 — CID 16979996
N-[2-[1-[4-(3,5-dimethylphenoxy)butyl]benzimidazol-2-yl]ethyl]-2-(4-phenylphenyl)acetamide (PubChem CID 16979996) has the molecular formula C35H37N3O2 and a molecular weight of 531.70 g/mol. Its IUPAC name is N-[2-[1-[4-(3,5-dimethylphenoxy)butyl]benzimidazol-2-yl]ethyl]-2-(4-phenylphenyl)acetamide.
| Compound Name | N-[2-[1-[4-(3,5-dimethylphenoxy)butyl]benzimidazol-2-yl]ethyl]-2-(4-phenylphenyl)acetamide |
|---|---|
| PubChem CID | 16979996 |
| Molecular Formula | C35H37N3O2 |
| Molecular Weight | 531.70 g/mol |
| Exact Mass | 531.29 |
| IUPAC Name | N-[2-[1-[4-(3,5-dimethylphenoxy)butyl]benzimidazol-2-yl]ethyl]-2-(4-phenylphenyl)acetamide |
| SMILES | Cc1cc(C)cc(OCCCCn2c(CCNC(=O)Cc3ccc(-c4ccccc4)cc3)nc3ccccc32)c1 |
| InChI | InChI=1S/C35H37N3O2/c1-26-22-27(2)24-31(23-26)40-21-9-8-20-38-33-13-7-6-12-32(33)37-34(38)18-19-36-35(39)25-28-14-16-30(17-15-28)29-10-4-3-5-11-29/h3-7,10-17,22-24H,8-9,18-21,25H2,1-2H3,(H,36,39) |
| InChIKey | KCBBEJRZNNUYQJ-UHFFFAOYSA-N |
| XLogP | 7.08 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.70 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|