C32H39N3O2 — CID 16991978
N-[5-[1-[4-(3,4-dimethylphenoxy)butyl]benzimidazol-2-yl]pentyl]-4-methylbenzamide (PubChem CID 16991978) has the molecular formula C32H39N3O2 and a molecular weight of 497.68 g/mol. Its IUPAC name is N-[5-[1-[4-(3,4-dimethylphenoxy)butyl]benzimidazol-2-yl]pentyl]-4-methylbenzamide.
| Compound Name | N-[5-[1-[4-(3,4-dimethylphenoxy)butyl]benzimidazol-2-yl]pentyl]-4-methylbenzamide |
|---|---|
| PubChem CID | 16991978 |
| Molecular Formula | C32H39N3O2 |
| Molecular Weight | 497.68 g/mol |
| Exact Mass | 497.30 |
| IUPAC Name | N-[5-[1-[4-(3,4-dimethylphenoxy)butyl]benzimidazol-2-yl]pentyl]-4-methylbenzamide |
| SMILES | Cc1ccc(C(=O)NCCCCCc2nc3ccccc3n2CCCCOc2ccc(C)c(C)c2)cc1 |
| InChI | InChI=1S/C32H39N3O2/c1-24-14-17-27(18-15-24)32(36)33-20-8-4-5-13-31-34-29-11-6-7-12-30(29)35(31)21-9-10-22-37-28-19-16-25(2)26(3)23-28/h6-7,11-12,14-19,23H,4-5,8-10,13,20-22H2,1-3H3,(H,33,36) |
| InChIKey | MCJHPZZFDNSLRU-UHFFFAOYSA-N |
| XLogP | 6.96 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.68 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|