C33H41N3O3 — CID 16994084
N-[5-[1-[4-(3,4-dimethylphenoxy)butyl]benzimidazol-2-yl]pentyl]-2-(4-methoxyphenyl)acetamide (PubChem CID 16994084) has the molecular formula C33H41N3O3 and a molecular weight of 527.71 g/mol. Its IUPAC name is N-[5-[1-[4-(3,4-dimethylphenoxy)butyl]benzimidazol-2-yl]pentyl]-2-(4-methoxyphenyl)acetamide.
| Compound Name | N-[5-[1-[4-(3,4-dimethylphenoxy)butyl]benzimidazol-2-yl]pentyl]-2-(4-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 16994084 |
| Molecular Formula | C33H41N3O3 |
| Molecular Weight | 527.71 g/mol |
| Exact Mass | 527.31 |
| IUPAC Name | N-[5-[1-[4-(3,4-dimethylphenoxy)butyl]benzimidazol-2-yl]pentyl]-2-(4-methoxyphenyl)acetamide |
| SMILES | COc1ccc(CC(=O)NCCCCCc2nc3ccccc3n2CCCCOc2ccc(C)c(C)c2)cc1 |
| InChI | InChI=1S/C33H41N3O3/c1-25-14-17-29(23-26(25)2)39-22-10-9-21-36-31-12-7-6-11-30(31)35-32(36)13-5-4-8-20-34-33(37)24-27-15-18-28(38-3)19-16-27/h6-7,11-12,14-19,23H,4-5,8-10,13,20-22,24H2,1-3H3,(H,34,37) |
| InChIKey | ZRLUNLFWLLVISW-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.71 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|