C31H37N3O3 — CID 16994029
N-[5-[1-[2-(3,5-dimethylphenoxy)ethyl]benzimidazol-2-yl]pentyl]-2-(4-methoxyphenyl)acetamide (PubChem CID 16994029) has the molecular formula C31H37N3O3 and a molecular weight of 499.66 g/mol. Its IUPAC name is N-[5-[1-[2-(3,5-dimethylphenoxy)ethyl]benzimidazol-2-yl]pentyl]-2-(4-methoxyphenyl)acetamide.
| Compound Name | N-[5-[1-[2-(3,5-dimethylphenoxy)ethyl]benzimidazol-2-yl]pentyl]-2-(4-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 16994029 |
| Molecular Formula | C31H37N3O3 |
| Molecular Weight | 499.66 g/mol |
| Exact Mass | 499.28 |
| IUPAC Name | N-[5-[1-[2-(3,5-dimethylphenoxy)ethyl]benzimidazol-2-yl]pentyl]-2-(4-methoxyphenyl)acetamide |
| SMILES | COc1ccc(CC(=O)NCCCCCc2nc3ccccc3n2CCOc2cc(C)cc(C)c2)cc1 |
| InChI | InChI=1S/C31H37N3O3/c1-23-19-24(2)21-27(20-23)37-18-17-34-29-10-7-6-9-28(29)33-30(34)11-5-4-8-16-32-31(35)22-25-12-14-26(36-3)15-13-25/h6-7,9-10,12-15,19-21H,4-5,8,11,16-18,22H2,1-3H3,(H,32,35) |
| InChIKey | YADILTNMDJRNLR-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.66 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|