C35H37N3O3 — CID 16994363
N-[5-[1-[2-(3-methoxyphenoxy)ethyl]benzimidazol-2-yl]pentyl]-2-(4-phenylphenyl)acetamide (PubChem CID 16994363) has the molecular formula C35H37N3O3 and a molecular weight of 547.70 g/mol. Its IUPAC name is N-[5-[1-[2-(3-methoxyphenoxy)ethyl]benzimidazol-2-yl]pentyl]-2-(4-phenylphenyl)acetamide.
| Compound Name | N-[5-[1-[2-(3-methoxyphenoxy)ethyl]benzimidazol-2-yl]pentyl]-2-(4-phenylphenyl)acetamide |
|---|---|
| PubChem CID | 16994363 |
| Molecular Formula | C35H37N3O3 |
| Molecular Weight | 547.70 g/mol |
| Exact Mass | 547.28 |
| IUPAC Name | N-[5-[1-[2-(3-methoxyphenoxy)ethyl]benzimidazol-2-yl]pentyl]-2-(4-phenylphenyl)acetamide |
| SMILES | COc1cccc(OCCn2c(CCCCCNC(=O)Cc3ccc(-c4ccccc4)cc3)nc3ccccc32)c1 |
| InChI | InChI=1S/C35H37N3O3/c1-40-30-13-10-14-31(26-30)41-24-23-38-33-16-8-7-15-32(33)37-34(38)17-6-3-9-22-36-35(39)25-27-18-20-29(21-19-27)28-11-4-2-5-12-28/h2,4-5,7-8,10-16,18-21,26H,3,6,9,17,22-25H2,1H3,(H,36,39) |
| InChIKey | BTSBILVKBZNQOK-UHFFFAOYSA-N |
| XLogP | 6.86 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.70 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|