C36H38ClN3O2 — CID 16994354
N-[5-[1-[2-(4-chloro-3,5-dimethylphenoxy)ethyl]benzimidazol-2-yl]pentyl]-2-(4-phenylphenyl)acetamide (PubChem CID 16994354) has the molecular formula C36H38ClN3O2 and a molecular weight of 580.17 g/mol. Its IUPAC name is N-[5-[1-[2-(4-chloro-3,5-dimethylphenoxy)ethyl]benzimidazol-2-yl]pentyl]-2-(4-phenylphenyl)acetamide.
| Compound Name | N-[5-[1-[2-(4-chloro-3,5-dimethylphenoxy)ethyl]benzimidazol-2-yl]pentyl]-2-(4-phenylphenyl)acetamide |
|---|---|
| PubChem CID | 16994354 |
| Molecular Formula | C36H38ClN3O2 |
| Molecular Weight | 580.17 g/mol |
| Exact Mass | 579.27 |
| IUPAC Name | N-[5-[1-[2-(4-chloro-3,5-dimethylphenoxy)ethyl]benzimidazol-2-yl]pentyl]-2-(4-phenylphenyl)acetamide |
| SMILES | Cc1cc(OCCn2c(CCCCCNC(=O)Cc3ccc(-c4ccccc4)cc3)nc3ccccc32)cc(C)c1Cl |
| InChI | InChI=1S/C36H38ClN3O2/c1-26-23-31(24-27(2)36(26)37)42-22-21-40-33-14-9-8-13-32(33)39-34(40)15-7-4-10-20-38-35(41)25-28-16-18-30(19-17-28)29-11-5-3-6-12-29/h3,5-6,8-9,11-14,16-19,23-24H,4,7,10,15,20-22,25H2,1-2H3,(H,38,41) |
| InChIKey | XXXKNIMIELMKPD-UHFFFAOYSA-N |
| XLogP | 8.12 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.17 |
| LogP ≤ 5 | 8.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|