C31H37N3O3 — CID 16994060
2-(4-methoxyphenyl)-N-[5-[1-[3-(4-methylphenoxy)propyl]benzimidazol-2-yl]pentyl]acetamide (PubChem CID 16994060) has the molecular formula C31H37N3O3 and a molecular weight of 499.66 g/mol. Its IUPAC name is 2-(4-methoxyphenyl)-N-[5-[1-[3-(4-methylphenoxy)propyl]benzimidazol-2-yl]pentyl]acetamide.
| Compound Name | 2-(4-methoxyphenyl)-N-[5-[1-[3-(4-methylphenoxy)propyl]benzimidazol-2-yl]pentyl]acetamide |
|---|---|
| PubChem CID | 16994060 |
| Molecular Formula | C31H37N3O3 |
| Molecular Weight | 499.66 g/mol |
| Exact Mass | 499.28 |
| IUPAC Name | 2-(4-methoxyphenyl)-N-[5-[1-[3-(4-methylphenoxy)propyl]benzimidazol-2-yl]pentyl]acetamide |
| SMILES | COc1ccc(CC(=O)NCCCCCc2nc3ccccc3n2CCCOc2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C31H37N3O3/c1-24-12-16-27(17-13-24)37-22-8-21-34-29-10-6-5-9-28(29)33-30(34)11-4-3-7-20-32-31(35)23-25-14-18-26(36-2)19-15-25/h5-6,9-10,12-19H,3-4,7-8,11,20-23H2,1-2H3,(H,32,35) |
| InChIKey | IQABSSAAALNUGD-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.66 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|