C31H37N3O4 — CID 16979832
2-(3,4-dimethoxyphenyl)-N-[2-[1-[4-(3,4-dimethylphenoxy)butyl]benzimidazol-2-yl]ethyl]acetamide (PubChem CID 16979832) has the molecular formula C31H37N3O4 and a molecular weight of 515.65 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenyl)-N-[2-[1-[4-(3,4-dimethylphenoxy)butyl]benzimidazol-2-yl]ethyl]acetamide.
| Compound Name | 2-(3,4-dimethoxyphenyl)-N-[2-[1-[4-(3,4-dimethylphenoxy)butyl]benzimidazol-2-yl]ethyl]acetamide |
|---|---|
| PubChem CID | 16979832 |
| Molecular Formula | C31H37N3O4 |
| Molecular Weight | 515.65 g/mol |
| Exact Mass | 515.28 |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)-N-[2-[1-[4-(3,4-dimethylphenoxy)butyl]benzimidazol-2-yl]ethyl]acetamide |
| SMILES | COc1ccc(CC(=O)NCCc2nc3ccccc3n2CCCCOc2ccc(C)c(C)c2)cc1OC |
| InChI | InChI=1S/C31H37N3O4/c1-22-11-13-25(19-23(22)2)38-18-8-7-17-34-27-10-6-5-9-26(27)33-30(34)15-16-32-31(35)21-24-12-14-28(36-3)29(20-24)37-4/h5-6,9-14,19-20H,7-8,15-18,21H2,1-4H3,(H,32,35) |
| InChIKey | HGBVDOPGKISFSI-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 74.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.65 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|