C30H35N3O4 — CID 16979792
2-(3,4-dimethoxyphenyl)-N-[2-[1-[3-(2,4-dimethylphenoxy)propyl]benzimidazol-2-yl]ethyl]acetamide (PubChem CID 16979792) has the molecular formula C30H35N3O4 and a molecular weight of 501.63 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenyl)-N-[2-[1-[3-(2,4-dimethylphenoxy)propyl]benzimidazol-2-yl]ethyl]acetamide.
| Compound Name | 2-(3,4-dimethoxyphenyl)-N-[2-[1-[3-(2,4-dimethylphenoxy)propyl]benzimidazol-2-yl]ethyl]acetamide |
|---|---|
| PubChem CID | 16979792 |
| Molecular Formula | C30H35N3O4 |
| Molecular Weight | 501.63 g/mol |
| Exact Mass | 501.26 |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)-N-[2-[1-[3-(2,4-dimethylphenoxy)propyl]benzimidazol-2-yl]ethyl]acetamide |
| SMILES | COc1ccc(CC(=O)NCCc2nc3ccccc3n2CCCOc2ccc(C)cc2C)cc1OC |
| InChI | InChI=1S/C30H35N3O4/c1-21-10-12-26(22(2)18-21)37-17-7-16-33-25-9-6-5-8-24(25)32-29(33)14-15-31-30(34)20-23-11-13-27(35-3)28(19-23)36-4/h5-6,8-13,18-19H,7,14-17,20H2,1-4H3,(H,31,34) |
| InChIKey | RHPLIGIKYXLNRX-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 74.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.63 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|