C29H33N3O5 — CID 16979798
2-(3,4-dimethoxyphenyl)-N-[2-[1-[3-(2-methoxyphenoxy)propyl]benzimidazol-2-yl]ethyl]acetamide (PubChem CID 16979798) has the molecular formula C29H33N3O5 and a molecular weight of 503.60 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenyl)-N-[2-[1-[3-(2-methoxyphenoxy)propyl]benzimidazol-2-yl]ethyl]acetamide.
| Compound Name | 2-(3,4-dimethoxyphenyl)-N-[2-[1-[3-(2-methoxyphenoxy)propyl]benzimidazol-2-yl]ethyl]acetamide |
|---|---|
| PubChem CID | 16979798 |
| Molecular Formula | C29H33N3O5 |
| Molecular Weight | 503.60 g/mol |
| Exact Mass | 503.24 |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)-N-[2-[1-[3-(2-methoxyphenoxy)propyl]benzimidazol-2-yl]ethyl]acetamide |
| SMILES | COc1ccc(CC(=O)NCCc2nc3ccccc3n2CCCOc2ccccc2OC)cc1OC |
| InChI | InChI=1S/C29H33N3O5/c1-34-24-11-6-7-12-26(24)37-18-8-17-32-23-10-5-4-9-22(23)31-28(32)15-16-30-29(33)20-21-13-14-25(35-2)27(19-21)36-3/h4-7,9-14,19H,8,15-18,20H2,1-3H3,(H,30,33) |
| InChIKey | BOGSFTTVYLVFHL-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 83.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.60 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|