C34H43N3O4 — CID 16994234
2-(3,4-dimethoxyphenyl)-N-[5-[1-[4-(2,3-dimethylphenoxy)butyl]benzimidazol-2-yl]pentyl]acetamide (PubChem CID 16994234) has the molecular formula C34H43N3O4 and a molecular weight of 557.74 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenyl)-N-[5-[1-[4-(2,3-dimethylphenoxy)butyl]benzimidazol-2-yl]pentyl]acetamide.
| Compound Name | 2-(3,4-dimethoxyphenyl)-N-[5-[1-[4-(2,3-dimethylphenoxy)butyl]benzimidazol-2-yl]pentyl]acetamide |
|---|---|
| PubChem CID | 16994234 |
| Molecular Formula | C34H43N3O4 |
| Molecular Weight | 557.74 g/mol |
| Exact Mass | 557.33 |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)-N-[5-[1-[4-(2,3-dimethylphenoxy)butyl]benzimidazol-2-yl]pentyl]acetamide |
| SMILES | COc1ccc(CC(=O)NCCCCCc2nc3ccccc3n2CCCCOc2cccc(C)c2C)cc1OC |
| InChI | InChI=1S/C34H43N3O4/c1-25-13-12-16-30(26(25)2)41-22-11-10-21-37-29-15-8-7-14-28(29)36-33(37)17-6-5-9-20-35-34(38)24-27-18-19-31(39-3)32(23-27)40-4/h7-8,12-16,18-19,23H,5-6,9-11,17,20-22,24H2,1-4H3,(H,35,38) |
| InChIKey | JRJABSMNJNFCDE-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 74.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.74 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|