C29H33N3O4 — CID 16976894
N-[2-[1-[3-(2,4-dimethylphenoxy)propyl]benzimidazol-2-yl]ethyl]-3,4-dimethoxybenzamide (PubChem CID 16976894) has the molecular formula C29H33N3O4 and a molecular weight of 487.60 g/mol. Its IUPAC name is N-[2-[1-[3-(2,4-dimethylphenoxy)propyl]benzimidazol-2-yl]ethyl]-3,4-dimethoxybenzamide.
| Compound Name | N-[2-[1-[3-(2,4-dimethylphenoxy)propyl]benzimidazol-2-yl]ethyl]-3,4-dimethoxybenzamide |
|---|---|
| PubChem CID | 16976894 |
| Molecular Formula | C29H33N3O4 |
| Molecular Weight | 487.60 g/mol |
| Exact Mass | 487.25 |
| IUPAC Name | N-[2-[1-[3-(2,4-dimethylphenoxy)propyl]benzimidazol-2-yl]ethyl]-3,4-dimethoxybenzamide |
| SMILES | COc1ccc(C(=O)NCCc2nc3ccccc3n2CCCOc2ccc(C)cc2C)cc1OC |
| InChI | InChI=1S/C29H33N3O4/c1-20-10-12-25(21(2)18-20)36-17-7-16-32-24-9-6-5-8-23(24)31-28(32)14-15-30-29(33)22-11-13-26(34-3)27(19-22)35-4/h5-6,8-13,18-19H,7,14-17H2,1-4H3,(H,30,33) |
| InChIKey | SGVNIYZRVYLGFH-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 74.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.60 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|