C30H34ClN3O4 — CID 16976975
N-[2-[1-[4-(4-chloro-3,5-dimethylphenoxy)butyl]benzimidazol-2-yl]ethyl]-3,4-dimethoxybenzamide (PubChem CID 16976975) has the molecular formula C30H34ClN3O4 and a molecular weight of 536.07 g/mol. Its IUPAC name is N-[2-[1-[4-(4-chloro-3,5-dimethylphenoxy)butyl]benzimidazol-2-yl]ethyl]-3,4-dimethoxybenzamide.
| Compound Name | N-[2-[1-[4-(4-chloro-3,5-dimethylphenoxy)butyl]benzimidazol-2-yl]ethyl]-3,4-dimethoxybenzamide |
|---|---|
| PubChem CID | 16976975 |
| Molecular Formula | C30H34ClN3O4 |
| Molecular Weight | 536.07 g/mol |
| Exact Mass | 535.22 |
| IUPAC Name | N-[2-[1-[4-(4-chloro-3,5-dimethylphenoxy)butyl]benzimidazol-2-yl]ethyl]-3,4-dimethoxybenzamide |
| SMILES | COc1ccc(C(=O)NCCc2nc3ccccc3n2CCCCOc2cc(C)c(Cl)c(C)c2)cc1OC |
| InChI | InChI=1S/C30H34ClN3O4/c1-20-17-23(18-21(2)29(20)31)38-16-8-7-15-34-25-10-6-5-9-24(25)33-28(34)13-14-32-30(35)22-11-12-26(36-3)27(19-22)37-4/h5-6,9-12,17-19H,7-8,13-16H2,1-4H3,(H,32,35) |
| InChIKey | RIEYITIXLATFEO-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 74.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.07 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|