C24H31N3O3 — CID 16976831
N-[2-(1-hexylbenzimidazol-2-yl)ethyl]-3,4-dimethoxybenzamide (PubChem CID 16976831) has the molecular formula C24H31N3O3 and a molecular weight of 409.53 g/mol. Its IUPAC name is N-[2-(1-hexylbenzimidazol-2-yl)ethyl]-3,4-dimethoxybenzamide.
| Compound Name | N-[2-(1-hexylbenzimidazol-2-yl)ethyl]-3,4-dimethoxybenzamide |
|---|---|
| PubChem CID | 16976831 |
| Molecular Formula | C24H31N3O3 |
| Molecular Weight | 409.53 g/mol |
| Exact Mass | 409.24 |
| IUPAC Name | N-[2-(1-hexylbenzimidazol-2-yl)ethyl]-3,4-dimethoxybenzamide |
| SMILES | CCCCCCn1c(CCNC(=O)c2ccc(OC)c(OC)c2)nc2ccccc21 |
| InChI | InChI=1S/C24H31N3O3/c1-4-5-6-9-16-27-20-11-8-7-10-19(20)26-23(27)14-15-25-24(28)18-12-13-21(29-2)22(17-18)30-3/h7-8,10-13,17H,4-6,9,14-16H2,1-3H3,(H,25,28) |
| InChIKey | CQXUKZNHXBRKCX-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.53 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|