C23H29N3O3 — CID 4688660
N-[3-(1-butylbenzimidazol-2-yl)propyl]-3,4-dimethoxybenzamide (PubChem CID 4688660) has the molecular formula C23H29N3O3 and a molecular weight of 395.50 g/mol. Its IUPAC name is N-[3-(1-butylbenzimidazol-2-yl)propyl]-3,4-dimethoxybenzamide.
| Compound Name | N-[3-(1-butylbenzimidazol-2-yl)propyl]-3,4-dimethoxybenzamide |
|---|---|
| PubChem CID | 4688660 |
| Molecular Formula | C23H29N3O3 |
| Molecular Weight | 395.50 g/mol |
| Exact Mass | 395.22 |
| IUPAC Name | N-[3-(1-butylbenzimidazol-2-yl)propyl]-3,4-dimethoxybenzamide |
| SMILES | CCCCn1c(CCCNC(=O)c2ccc(OC)c(OC)c2)nc2ccccc21 |
| InChI | InChI=1S/C23H29N3O3/c1-4-5-15-26-19-10-7-6-9-18(19)25-22(26)11-8-14-24-23(27)17-12-13-20(28-2)21(16-17)29-3/h6-7,9-10,12-13,16H,4-5,8,11,14-15H2,1-3H3,(H,24,27) |
| InChIKey | OPHHVNNHSVZBGO-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.50 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|