C30H35N3O5 — CID 16990960
3,4-dimethoxy-N-[5-[1-[2-(4-methoxyphenoxy)ethyl]benzimidazol-2-yl]pentyl]benzamide (PubChem CID 16990960) has the molecular formula C30H35N3O5 and a molecular weight of 517.63 g/mol. Its IUPAC name is 3,4-dimethoxy-N-[5-[1-[2-(4-methoxyphenoxy)ethyl]benzimidazol-2-yl]pentyl]benzamide.
| Compound Name | 3,4-dimethoxy-N-[5-[1-[2-(4-methoxyphenoxy)ethyl]benzimidazol-2-yl]pentyl]benzamide |
|---|---|
| PubChem CID | 16990960 |
| Molecular Formula | C30H35N3O5 |
| Molecular Weight | 517.63 g/mol |
| Exact Mass | 517.26 |
| IUPAC Name | 3,4-dimethoxy-N-[5-[1-[2-(4-methoxyphenoxy)ethyl]benzimidazol-2-yl]pentyl]benzamide |
| SMILES | COc1ccc(OCCn2c(CCCCCNC(=O)c3ccc(OC)c(OC)c3)nc3ccccc32)cc1 |
| InChI | InChI=1S/C30H35N3O5/c1-35-23-13-15-24(16-14-23)38-20-19-33-26-10-7-6-9-25(26)32-29(33)11-5-4-8-18-31-30(34)22-12-17-27(36-2)28(21-22)37-3/h6-7,9-10,12-17,21H,4-5,8,11,18-20H2,1-3H3,(H,31,34) |
| InChIKey | JKMZXBKBCLIALT-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 83.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.63 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|