C28H30ClN3O3 — CID 16991278
N-[5-[1-[2-(4-chlorophenoxy)ethyl]benzimidazol-2-yl]pentyl]-4-methoxybenzamide (PubChem CID 16991278) has the molecular formula C28H30ClN3O3 and a molecular weight of 492.02 g/mol. Its IUPAC name is N-[5-[1-[2-(4-chlorophenoxy)ethyl]benzimidazol-2-yl]pentyl]-4-methoxybenzamide.
| Compound Name | N-[5-[1-[2-(4-chlorophenoxy)ethyl]benzimidazol-2-yl]pentyl]-4-methoxybenzamide |
|---|---|
| PubChem CID | 16991278 |
| Molecular Formula | C28H30ClN3O3 |
| Molecular Weight | 492.02 g/mol |
| Exact Mass | 491.20 |
| IUPAC Name | N-[5-[1-[2-(4-chlorophenoxy)ethyl]benzimidazol-2-yl]pentyl]-4-methoxybenzamide |
| SMILES | COc1ccc(C(=O)NCCCCCc2nc3ccccc3n2CCOc2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C28H30ClN3O3/c1-34-23-14-10-21(11-15-23)28(33)30-18-6-2-3-9-27-31-25-7-4-5-8-26(25)32(27)19-20-35-24-16-12-22(29)13-17-24/h4-5,7-8,10-17H,2-3,6,9,18-20H2,1H3,(H,30,33) |
| InChIKey | FKDHELRTFVGMEZ-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.02 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|