C31H36ClN3O2 — CID 16991498
4-chloro-N-[5-[1-[4-(4-ethylphenoxy)butyl]benzimidazol-2-yl]pentyl]benzamide (PubChem CID 16991498) has the molecular formula C31H36ClN3O2 and a molecular weight of 518.10 g/mol. Its IUPAC name is 4-chloro-N-[5-[1-[4-(4-ethylphenoxy)butyl]benzimidazol-2-yl]pentyl]benzamide.
| Compound Name | 4-chloro-N-[5-[1-[4-(4-ethylphenoxy)butyl]benzimidazol-2-yl]pentyl]benzamide |
|---|---|
| PubChem CID | 16991498 |
| Molecular Formula | C31H36ClN3O2 |
| Molecular Weight | 518.10 g/mol |
| Exact Mass | 517.25 |
| IUPAC Name | 4-chloro-N-[5-[1-[4-(4-ethylphenoxy)butyl]benzimidazol-2-yl]pentyl]benzamide |
| SMILES | CCc1ccc(OCCCCn2c(CCCCCNC(=O)c3ccc(Cl)cc3)nc3ccccc32)cc1 |
| InChI | InChI=1S/C31H36ClN3O2/c1-2-24-13-19-27(20-14-24)37-23-9-8-22-35-29-11-6-5-10-28(29)34-30(35)12-4-3-7-21-33-31(36)25-15-17-26(32)18-16-25/h5-6,10-11,13-20H,2-4,7-9,12,21-23H2,1H3,(H,33,36) |
| InChIKey | ZUHNBLYZZPJYSA-UHFFFAOYSA-N |
| XLogP | 7.25 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.10 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|