C30H35N3O3 — CID 16991264
N-[5-[1-[2-(2,4-dimethylphenoxy)ethyl]benzimidazol-2-yl]pentyl]-4-methoxybenzamide (PubChem CID 16991264) has the molecular formula C30H35N3O3 and a molecular weight of 485.63 g/mol. Its IUPAC name is N-[5-[1-[2-(2,4-dimethylphenoxy)ethyl]benzimidazol-2-yl]pentyl]-4-methoxybenzamide.
| Compound Name | N-[5-[1-[2-(2,4-dimethylphenoxy)ethyl]benzimidazol-2-yl]pentyl]-4-methoxybenzamide |
|---|---|
| PubChem CID | 16991264 |
| Molecular Formula | C30H35N3O3 |
| Molecular Weight | 485.63 g/mol |
| Exact Mass | 485.27 |
| IUPAC Name | N-[5-[1-[2-(2,4-dimethylphenoxy)ethyl]benzimidazol-2-yl]pentyl]-4-methoxybenzamide |
| SMILES | COc1ccc(C(=O)NCCCCCc2nc3ccccc3n2CCOc2ccc(C)cc2C)cc1 |
| InChI | InChI=1S/C30H35N3O3/c1-22-12-17-28(23(2)21-22)36-20-19-33-27-10-7-6-9-26(27)32-29(33)11-5-4-8-18-31-30(34)24-13-15-25(35-3)16-14-24/h6-7,9-10,12-17,21H,4-5,8,11,18-20H2,1-3H3,(H,31,34) |
| InChIKey | GNAAEHHLBXKQFK-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.63 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|