C33H41N3O4 — CID 16990997
N-[5-[1-[4-(2,5-dimethylphenoxy)butyl]benzimidazol-2-yl]pentyl]-3,4-dimethoxybenzamide (PubChem CID 16990997) has the molecular formula C33H41N3O4 and a molecular weight of 543.71 g/mol. Its IUPAC name is N-[5-[1-[4-(2,5-dimethylphenoxy)butyl]benzimidazol-2-yl]pentyl]-3,4-dimethoxybenzamide.
| Compound Name | N-[5-[1-[4-(2,5-dimethylphenoxy)butyl]benzimidazol-2-yl]pentyl]-3,4-dimethoxybenzamide |
|---|---|
| PubChem CID | 16990997 |
| Molecular Formula | C33H41N3O4 |
| Molecular Weight | 543.71 g/mol |
| Exact Mass | 543.31 |
| IUPAC Name | N-[5-[1-[4-(2,5-dimethylphenoxy)butyl]benzimidazol-2-yl]pentyl]-3,4-dimethoxybenzamide |
| SMILES | COc1ccc(C(=O)NCCCCCc2nc3ccccc3n2CCCCOc2cc(C)ccc2C)cc1OC |
| InChI | InChI=1S/C33H41N3O4/c1-24-15-16-25(2)30(22-24)40-21-11-10-20-36-28-13-8-7-12-27(28)35-32(36)14-6-5-9-19-34-33(37)26-17-18-29(38-3)31(23-26)39-4/h7-8,12-13,15-18,22-23H,5-6,9-11,14,19-21H2,1-4H3,(H,34,37) |
| InChIKey | XYIYVKCPZVLFOH-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 74.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.71 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|