C27H37N3O3 — CID 16983788
3,4-dimethoxy-N-[3-(1-octylbenzimidazol-2-yl)propyl]benzamide (PubChem CID 16983788) has the molecular formula C27H37N3O3 and a molecular weight of 451.61 g/mol. Its IUPAC name is 3,4-dimethoxy-N-[3-(1-octylbenzimidazol-2-yl)propyl]benzamide.
| Compound Name | 3,4-dimethoxy-N-[3-(1-octylbenzimidazol-2-yl)propyl]benzamide |
|---|---|
| PubChem CID | 16983788 |
| Molecular Formula | C27H37N3O3 |
| Molecular Weight | 451.61 g/mol |
| Exact Mass | 451.28 |
| IUPAC Name | 3,4-dimethoxy-N-[3-(1-octylbenzimidazol-2-yl)propyl]benzamide |
| SMILES | CCCCCCCCn1c(CCCNC(=O)c2ccc(OC)c(OC)c2)nc2ccccc21 |
| InChI | InChI=1S/C27H37N3O3/c1-4-5-6-7-8-11-19-30-23-14-10-9-13-22(23)29-26(30)15-12-18-28-27(31)21-16-17-24(32-2)25(20-21)33-3/h9-10,13-14,16-17,20H,4-8,11-12,15,18-19H2,1-3H3,(H,28,31) |
| InChIKey | BILLHQUSTKFJJR-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.61 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|