C27H27Cl2N3O2 — CID 16976118
2-chloro-N-[2-[1-[3-(4-chloro-3,5-dimethylphenoxy)propyl]benzimidazol-2-yl]ethyl]benzamide (PubChem CID 16976118) has the molecular formula C27H27Cl2N3O2 and a molecular weight of 496.44 g/mol. Its IUPAC name is 2-chloro-N-[2-[1-[3-(4-chloro-3,5-dimethylphenoxy)propyl]benzimidazol-2-yl]ethyl]benzamide.
| Compound Name | 2-chloro-N-[2-[1-[3-(4-chloro-3,5-dimethylphenoxy)propyl]benzimidazol-2-yl]ethyl]benzamide |
|---|---|
| PubChem CID | 16976118 |
| Molecular Formula | C27H27Cl2N3O2 |
| Molecular Weight | 496.44 g/mol |
| Exact Mass | 495.15 |
| IUPAC Name | 2-chloro-N-[2-[1-[3-(4-chloro-3,5-dimethylphenoxy)propyl]benzimidazol-2-yl]ethyl]benzamide |
| SMILES | Cc1cc(OCCCn2c(CCNC(=O)c3ccccc3Cl)nc3ccccc32)cc(C)c1Cl |
| InChI | InChI=1S/C27H27Cl2N3O2/c1-18-16-20(17-19(2)26(18)29)34-15-7-14-32-24-11-6-5-10-23(24)31-25(32)12-13-30-27(33)21-8-3-4-9-22(21)28/h3-6,8-11,16-17H,7,12-15H2,1-2H3,(H,30,33) |
| InChIKey | XMVNACYQUUJKJI-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.44 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|