C31H36ClN3O2 — CID 16982662
N-[3-[1-[4-(4-chloro-3,5-dimethylphenoxy)butyl]benzimidazol-2-yl]propyl]-2,4-dimethylbenzamide (PubChem CID 16982662) has the molecular formula C31H36ClN3O2 and a molecular weight of 518.10 g/mol. Its IUPAC name is N-[3-[1-[4-(4-chloro-3,5-dimethylphenoxy)butyl]benzimidazol-2-yl]propyl]-2,4-dimethylbenzamide.
| Compound Name | N-[3-[1-[4-(4-chloro-3,5-dimethylphenoxy)butyl]benzimidazol-2-yl]propyl]-2,4-dimethylbenzamide |
|---|---|
| PubChem CID | 16982662 |
| Molecular Formula | C31H36ClN3O2 |
| Molecular Weight | 518.10 g/mol |
| Exact Mass | 517.25 |
| IUPAC Name | N-[3-[1-[4-(4-chloro-3,5-dimethylphenoxy)butyl]benzimidazol-2-yl]propyl]-2,4-dimethylbenzamide |
| SMILES | Cc1ccc(C(=O)NCCCc2nc3ccccc3n2CCCCOc2cc(C)c(Cl)c(C)c2)c(C)c1 |
| InChI | InChI=1S/C31H36ClN3O2/c1-21-13-14-26(22(2)18-21)31(36)33-15-9-12-29-34-27-10-5-6-11-28(27)35(29)16-7-8-17-37-25-19-23(3)30(32)24(4)20-25/h5-6,10-11,13-14,18-20H,7-9,12,15-17H2,1-4H3,(H,33,36) |
| InChIKey | RAILFNRCZBFBAS-UHFFFAOYSA-N |
| XLogP | 7.15 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.10 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|