C31H37N3O2 — CID 16989680
2,4-dimethyl-N-[5-[1-[3-(3-methylphenoxy)propyl]benzimidazol-2-yl]pentyl]benzamide (PubChem CID 16989680) has the molecular formula C31H37N3O2 and a molecular weight of 483.66 g/mol. Its IUPAC name is 2,4-dimethyl-N-[5-[1-[3-(3-methylphenoxy)propyl]benzimidazol-2-yl]pentyl]benzamide.
| Compound Name | 2,4-dimethyl-N-[5-[1-[3-(3-methylphenoxy)propyl]benzimidazol-2-yl]pentyl]benzamide |
|---|---|
| PubChem CID | 16989680 |
| Molecular Formula | C31H37N3O2 |
| Molecular Weight | 483.66 g/mol |
| Exact Mass | 483.29 |
| IUPAC Name | 2,4-dimethyl-N-[5-[1-[3-(3-methylphenoxy)propyl]benzimidazol-2-yl]pentyl]benzamide |
| SMILES | Cc1cccc(OCCCn2c(CCCCCNC(=O)c3ccc(C)cc3C)nc3ccccc32)c1 |
| InChI | InChI=1S/C31H37N3O2/c1-23-11-9-12-26(22-23)36-20-10-19-34-29-14-7-6-13-28(29)33-30(34)15-5-4-8-18-32-31(35)27-17-16-24(2)21-25(27)3/h6-7,9,11-14,16-17,21-22H,4-5,8,10,15,18-20H2,1-3H3,(H,32,35) |
| InChIKey | XAOSMZLORQXUSD-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.66 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|