C25H33N3O — CID 16982514
N-[3-(1-hexylbenzimidazol-2-yl)propyl]-2,4-dimethylbenzamide (PubChem CID 16982514) has the molecular formula C25H33N3O and a molecular weight of 391.56 g/mol. Its IUPAC name is N-[3-(1-hexylbenzimidazol-2-yl)propyl]-2,4-dimethylbenzamide.
| Compound Name | N-[3-(1-hexylbenzimidazol-2-yl)propyl]-2,4-dimethylbenzamide |
|---|---|
| PubChem CID | 16982514 |
| Molecular Formula | C25H33N3O |
| Molecular Weight | 391.56 g/mol |
| Exact Mass | 391.26 |
| IUPAC Name | N-[3-(1-hexylbenzimidazol-2-yl)propyl]-2,4-dimethylbenzamide |
| SMILES | CCCCCCn1c(CCCNC(=O)c2ccc(C)cc2C)nc2ccccc21 |
| InChI | InChI=1S/C25H33N3O/c1-4-5-6-9-17-28-23-12-8-7-11-22(23)27-24(28)13-10-16-26-25(29)21-15-14-19(2)18-20(21)3/h7-8,11-12,14-15,18H,4-6,9-10,13,16-17H2,1-3H3,(H,26,29) |
| InChIKey | HNIGCQBRCPKVPJ-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.56 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|