C27H37N3O — CID 16982516
2,4-dimethyl-N-[3-(1-octylbenzimidazol-2-yl)propyl]benzamide (PubChem CID 16982516) has the molecular formula C27H37N3O and a molecular weight of 419.61 g/mol. Its IUPAC name is 2,4-dimethyl-N-[3-(1-octylbenzimidazol-2-yl)propyl]benzamide.
| Compound Name | 2,4-dimethyl-N-[3-(1-octylbenzimidazol-2-yl)propyl]benzamide |
|---|---|
| PubChem CID | 16982516 |
| Molecular Formula | C27H37N3O |
| Molecular Weight | 419.61 g/mol |
| Exact Mass | 419.29 |
| IUPAC Name | 2,4-dimethyl-N-[3-(1-octylbenzimidazol-2-yl)propyl]benzamide |
| SMILES | CCCCCCCCn1c(CCCNC(=O)c2ccc(C)cc2C)nc2ccccc21 |
| InChI | InChI=1S/C27H37N3O/c1-4-5-6-7-8-11-19-30-25-14-10-9-13-24(25)29-26(30)15-12-18-28-27(31)23-17-16-21(2)20-22(23)3/h9-10,13-14,16-17,20H,4-8,11-12,15,18-19H2,1-3H3,(H,28,31) |
| InChIKey | YAEKMMKALZTBOQ-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.61 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|