C33H47N3O2 — CID 16989070
N-[5-[1-[4-(4-tert-butylphenoxy)butyl]benzimidazol-2-yl]pentyl]cyclohexanecarboxamide (PubChem CID 16989070) has the molecular formula C33H47N3O2 and a molecular weight of 517.76 g/mol. Its IUPAC name is N-[5-[1-[4-(4-tert-butylphenoxy)butyl]benzimidazol-2-yl]pentyl]cyclohexanecarboxamide.
| Compound Name | N-[5-[1-[4-(4-tert-butylphenoxy)butyl]benzimidazol-2-yl]pentyl]cyclohexanecarboxamide |
|---|---|
| PubChem CID | 16989070 |
| Molecular Formula | C33H47N3O2 |
| Molecular Weight | 517.76 g/mol |
| Exact Mass | 517.37 |
| IUPAC Name | N-[5-[1-[4-(4-tert-butylphenoxy)butyl]benzimidazol-2-yl]pentyl]cyclohexanecarboxamide |
| SMILES | CC(C)(C)c1ccc(OCCCCn2c(CCCCCNC(=O)C3CCCCC3)nc3ccccc32)cc1 |
| InChI | InChI=1S/C33H47N3O2/c1-33(2,3)27-19-21-28(22-20-27)38-25-13-12-24-36-30-17-10-9-16-29(30)35-31(36)18-8-5-11-23-34-32(37)26-14-6-4-7-15-26/h9-10,16-17,19-22,26H,4-8,11-15,18,23-25H2,1-3H3,(H,34,37) |
| InChIKey | VWRNTSTVWNVEAW-UHFFFAOYSA-N |
| XLogP | 7.60 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.76 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|