C22H31N3O3 — CID 16989094
methyl 2-[2-[5-(cyclohexanecarbonylamino)pentyl]benzimidazol-1-yl]acetate (PubChem CID 16989094) has the molecular formula C22H31N3O3 and a molecular weight of 385.51 g/mol. Its IUPAC name is methyl 2-[2-[5-(cyclohexanecarbonylamino)pentyl]benzimidazol-1-yl]acetate.
| Compound Name | methyl 2-[2-[5-(cyclohexanecarbonylamino)pentyl]benzimidazol-1-yl]acetate |
|---|---|
| PubChem CID | 16989094 |
| Molecular Formula | C22H31N3O3 |
| Molecular Weight | 385.51 g/mol |
| Exact Mass | 385.24 |
| IUPAC Name | methyl 2-[2-[5-(cyclohexanecarbonylamino)pentyl]benzimidazol-1-yl]acetate |
| SMILES | COC(=O)Cn1c(CCCCCNC(=O)C2CCCCC2)nc2ccccc21 |
| InChI | InChI=1S/C22H31N3O3/c1-28-21(26)16-25-19-13-8-7-12-18(19)24-20(25)14-6-3-9-15-23-22(27)17-10-4-2-5-11-17/h7-8,12-13,17H,2-6,9-11,14-16H2,1H3,(H,23,27) |
| InChIKey | PZAKLSROYNSVGY-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.51 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|