C24H37N3O — CID 16988953
N-[5-[1-(3-methylbutyl)benzimidazol-2-yl]pentyl]cyclohexanecarboxamide (PubChem CID 16988953) has the molecular formula C24H37N3O and a molecular weight of 383.58 g/mol. Its IUPAC name is N-[5-[1-(3-methylbutyl)benzimidazol-2-yl]pentyl]cyclohexanecarboxamide.
| Compound Name | N-[5-[1-(3-methylbutyl)benzimidazol-2-yl]pentyl]cyclohexanecarboxamide |
|---|---|
| PubChem CID | 16988953 |
| Molecular Formula | C24H37N3O |
| Molecular Weight | 383.58 g/mol |
| Exact Mass | 383.29 |
| IUPAC Name | N-[5-[1-(3-methylbutyl)benzimidazol-2-yl]pentyl]cyclohexanecarboxamide |
| SMILES | CC(C)CCn1c(CCCCCNC(=O)C2CCCCC2)nc2ccccc21 |
| InChI | InChI=1S/C24H37N3O/c1-19(2)16-18-27-22-14-9-8-13-21(22)26-23(27)15-7-4-10-17-25-24(28)20-11-5-3-6-12-20/h8-9,13-14,19-20H,3-7,10-12,15-18H2,1-2H3,(H,25,28) |
| InChIKey | DZZJMQIQERWQNF-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.58 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|