C28H42N4O2 — CID 16989093
N-[5-[1-[3-(azepan-1-yl)-3-oxopropyl]benzimidazol-2-yl]pentyl]cyclohexanecarboxamide (PubChem CID 16989093) has the molecular formula C28H42N4O2 and a molecular weight of 466.67 g/mol. Its IUPAC name is N-[5-[1-[3-(azepan-1-yl)-3-oxopropyl]benzimidazol-2-yl]pentyl]cyclohexanecarboxamide.
| Compound Name | N-[5-[1-[3-(azepan-1-yl)-3-oxopropyl]benzimidazol-2-yl]pentyl]cyclohexanecarboxamide |
|---|---|
| PubChem CID | 16989093 |
| Molecular Formula | C28H42N4O2 |
| Molecular Weight | 466.67 g/mol |
| Exact Mass | 466.33 |
| IUPAC Name | N-[5-[1-[3-(azepan-1-yl)-3-oxopropyl]benzimidazol-2-yl]pentyl]cyclohexanecarboxamide |
| SMILES | O=C(NCCCCCc1nc2ccccc2n1CCC(=O)N1CCCCCC1)C1CCCCC1 |
| InChI | InChI=1S/C28H42N4O2/c33-27(31-20-11-1-2-12-21-31)18-22-32-25-16-9-8-15-24(25)30-26(32)17-7-4-10-19-29-28(34)23-13-5-3-6-14-23/h8-9,15-16,23H,1-7,10-14,17-22H2,(H,29,34) |
| InChIKey | NDWBBLPQOFCWAO-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.67 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|