C26H35N3O2 — CID 16974769
N-[2-[1-[3-(2,3-dimethylphenoxy)propyl]benzimidazol-2-yl]ethyl]-2-ethylbutanamide (PubChem CID 16974769) has the molecular formula C26H35N3O2 and a molecular weight of 421.59 g/mol. Its IUPAC name is N-[2-[1-[3-(2,3-dimethylphenoxy)propyl]benzimidazol-2-yl]ethyl]-2-ethylbutanamide.
| Compound Name | N-[2-[1-[3-(2,3-dimethylphenoxy)propyl]benzimidazol-2-yl]ethyl]-2-ethylbutanamide |
|---|---|
| PubChem CID | 16974769 |
| Molecular Formula | C26H35N3O2 |
| Molecular Weight | 421.59 g/mol |
| Exact Mass | 421.27 |
| IUPAC Name | N-[2-[1-[3-(2,3-dimethylphenoxy)propyl]benzimidazol-2-yl]ethyl]-2-ethylbutanamide |
| SMILES | CCC(CC)C(=O)NCCc1nc2ccccc2n1CCCOc1cccc(C)c1C |
| InChI | InChI=1S/C26H35N3O2/c1-5-21(6-2)26(30)27-16-15-25-28-22-12-7-8-13-23(22)29(25)17-10-18-31-24-14-9-11-19(3)20(24)4/h7-9,11-14,21H,5-6,10,15-18H2,1-4H3,(H,27,30) |
| InChIKey | ABPBLMPWKHRQTK-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.59 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|