C32H39N3O6 — CID 16991134
3,4,5-trimethoxy-N-[5-[1-[3-(2-methoxyphenoxy)propyl]benzimidazol-2-yl]pentyl]benzamide (PubChem CID 16991134) has the molecular formula C32H39N3O6 and a molecular weight of 561.68 g/mol. Its IUPAC name is 3,4,5-trimethoxy-N-[5-[1-[3-(2-methoxyphenoxy)propyl]benzimidazol-2-yl]pentyl]benzamide.
| Compound Name | 3,4,5-trimethoxy-N-[5-[1-[3-(2-methoxyphenoxy)propyl]benzimidazol-2-yl]pentyl]benzamide |
|---|---|
| PubChem CID | 16991134 |
| Molecular Formula | C32H39N3O6 |
| Molecular Weight | 561.68 g/mol |
| Exact Mass | 561.28 |
| IUPAC Name | 3,4,5-trimethoxy-N-[5-[1-[3-(2-methoxyphenoxy)propyl]benzimidazol-2-yl]pentyl]benzamide |
| SMILES | COc1ccccc1OCCCn1c(CCCCCNC(=O)c2cc(OC)c(OC)c(OC)c2)nc2ccccc21 |
| InChI | InChI=1S/C32H39N3O6/c1-37-26-15-9-10-16-27(26)41-20-12-19-35-25-14-8-7-13-24(25)34-30(35)17-6-5-11-18-33-32(36)23-21-28(38-2)31(40-4)29(22-23)39-3/h7-10,13-16,21-22H,5-6,11-12,17-20H2,1-4H3,(H,33,36) |
| InChIKey | DVTQAWIGYOURQF-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 93.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.68 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|