C36H45N3O6 — CID 16991165
3,4,5-trimethoxy-N-[5-[1-[4-[2-methoxy-4-[(E)-prop-1-enyl]phenoxy]butyl]benzimidazol-2-yl]pentyl]benzamide (PubChem CID 16991165) has the molecular formula C36H45N3O6 and a molecular weight of 615.77 g/mol. Its IUPAC name is 3,4,5-trimethoxy-N-[5-[1-[4-[2-methoxy-4-[(E)-prop-1-enyl]phenoxy]butyl]benzimidazol-2-yl]pentyl]benzamide.
| Compound Name | 3,4,5-trimethoxy-N-[5-[1-[4-[2-methoxy-4-[(E)-prop-1-enyl]phenoxy]butyl]benzimidazol-2-yl]pentyl]benzamide |
|---|---|
| PubChem CID | 16991165 |
| Molecular Formula | C36H45N3O6 |
| Molecular Weight | 615.77 g/mol |
| Exact Mass | 615.33 |
| IUPAC Name | 3,4,5-trimethoxy-N-[5-[1-[4-[2-methoxy-4-[(E)-prop-1-enyl]phenoxy]butyl]benzimidazol-2-yl]pentyl]benzamide |
| SMILES | C/C=C/c1ccc(OCCCCn2c(CCCCCNC(=O)c3cc(OC)c(OC)c(OC)c3)nc3ccccc32)c(OC)c1 |
| InChI | InChI=1S/C36H45N3O6/c1-6-14-26-18-19-30(31(23-26)41-2)45-22-13-12-21-39-29-16-10-9-15-28(29)38-34(39)17-8-7-11-20-37-36(40)27-24-32(42-3)35(44-5)33(25-27)43-4/h6,9-10,14-16,18-19,23-25H,7-8,11-13,17,20-22H2,1-5H3,(H,37,40)/b14-6+ |
| InChIKey | LROXIJIPZCKCIR-MKMNVTDBSA-N |
| XLogP | 7.11 |
| TPSA | 93.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.77 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|