C34H41N3O5 — CID 16990974
3,4-dimethoxy-N-[5-[1-[3-[2-methoxy-4-[(E)-prop-1-enyl]phenoxy]propyl]benzimidazol-2-yl]pentyl]benzamide (PubChem CID 16990974) has the molecular formula C34H41N3O5 and a molecular weight of 571.72 g/mol. Its IUPAC name is 3,4-dimethoxy-N-[5-[1-[3-[2-methoxy-4-[(E)-prop-1-enyl]phenoxy]propyl]benzimidazol-2-yl]pentyl]benzamide.
| Compound Name | 3,4-dimethoxy-N-[5-[1-[3-[2-methoxy-4-[(E)-prop-1-enyl]phenoxy]propyl]benzimidazol-2-yl]pentyl]benzamide |
|---|---|
| PubChem CID | 16990974 |
| Molecular Formula | C34H41N3O5 |
| Molecular Weight | 571.72 g/mol |
| Exact Mass | 571.30 |
| IUPAC Name | 3,4-dimethoxy-N-[5-[1-[3-[2-methoxy-4-[(E)-prop-1-enyl]phenoxy]propyl]benzimidazol-2-yl]pentyl]benzamide |
| SMILES | C/C=C/c1ccc(OCCCn2c(CCCCCNC(=O)c3ccc(OC)c(OC)c3)nc3ccccc32)c(OC)c1 |
| InChI | InChI=1S/C34H41N3O5/c1-5-12-25-16-18-30(31(23-25)40-3)42-22-11-21-37-28-14-9-8-13-27(28)36-33(37)15-7-6-10-20-35-34(38)26-17-19-29(39-2)32(24-26)41-4/h5,8-9,12-14,16-19,23-24H,6-7,10-11,15,20-22H2,1-4H3,(H,35,38)/b12-5+ |
| InChIKey | AYEREMSVJBSCSO-LFYBBSHMSA-N |
| XLogP | 6.71 |
| TPSA | 83.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.72 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|