C33H39N3O3 — CID 16991946
N-[5-[1-[3-[2-methoxy-4-[(E)-prop-1-enyl]phenoxy]propyl]benzimidazol-2-yl]pentyl]-4-methylbenzamide (PubChem CID 16991946) has the molecular formula C33H39N3O3 and a molecular weight of 525.69 g/mol. Its IUPAC name is N-[5-[1-[3-[2-methoxy-4-[(E)-prop-1-enyl]phenoxy]propyl]benzimidazol-2-yl]pentyl]-4-methylbenzamide.
| Compound Name | N-[5-[1-[3-[2-methoxy-4-[(E)-prop-1-enyl]phenoxy]propyl]benzimidazol-2-yl]pentyl]-4-methylbenzamide |
|---|---|
| PubChem CID | 16991946 |
| Molecular Formula | C33H39N3O3 |
| Molecular Weight | 525.69 g/mol |
| Exact Mass | 525.30 |
| IUPAC Name | N-[5-[1-[3-[2-methoxy-4-[(E)-prop-1-enyl]phenoxy]propyl]benzimidazol-2-yl]pentyl]-4-methylbenzamide |
| SMILES | C/C=C/c1ccc(OCCCn2c(CCCCCNC(=O)c3ccc(C)cc3)nc3ccccc32)c(OC)c1 |
| InChI | InChI=1S/C33H39N3O3/c1-4-11-26-17-20-30(31(24-26)38-3)39-23-10-22-36-29-13-8-7-12-28(29)35-32(36)14-6-5-9-21-34-33(37)27-18-15-25(2)16-19-27/h4,7-8,11-13,15-20,24H,5-6,9-10,14,21-23H2,1-3H3,(H,34,37)/b11-4+ |
| InChIKey | ZACMWDCGTNBJGH-NYYWCZLTSA-N |
| XLogP | 7.00 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.69 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|