C35H43N3O3 — CID 16989707
N-[5-[1-[4-[2-methoxy-4-[(E)-prop-1-enyl]phenoxy]butyl]benzimidazol-2-yl]pentyl]-2,4-dimethylbenzamide (PubChem CID 16989707) has the molecular formula C35H43N3O3 and a molecular weight of 553.75 g/mol. Its IUPAC name is N-[5-[1-[4-[2-methoxy-4-[(E)-prop-1-enyl]phenoxy]butyl]benzimidazol-2-yl]pentyl]-2,4-dimethylbenzamide.
| Compound Name | N-[5-[1-[4-[2-methoxy-4-[(E)-prop-1-enyl]phenoxy]butyl]benzimidazol-2-yl]pentyl]-2,4-dimethylbenzamide |
|---|---|
| PubChem CID | 16989707 |
| Molecular Formula | C35H43N3O3 |
| Molecular Weight | 553.75 g/mol |
| Exact Mass | 553.33 |
| IUPAC Name | N-[5-[1-[4-[2-methoxy-4-[(E)-prop-1-enyl]phenoxy]butyl]benzimidazol-2-yl]pentyl]-2,4-dimethylbenzamide |
| SMILES | C/C=C/c1ccc(OCCCCn2c(CCCCCNC(=O)c3ccc(C)cc3C)nc3ccccc32)c(OC)c1 |
| InChI | InChI=1S/C35H43N3O3/c1-5-13-28-18-20-32(33(25-28)40-4)41-23-12-11-22-38-31-15-9-8-14-30(31)37-34(38)16-7-6-10-21-36-35(39)29-19-17-26(2)24-27(29)3/h5,8-9,13-15,17-20,24-25H,6-7,10-12,16,21-23H2,1-4H3,(H,36,39)/b13-5+ |
| InChIKey | CAIBJOPPCLBEOU-WLRTZDKTSA-N |
| XLogP | 7.70 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.75 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|