C34H41N3O3 — CID 16993433
N-[5-[1-[4-[2-methoxy-4-[(E)-prop-1-enyl]phenoxy]butyl]benzimidazol-2-yl]pentyl]-2-phenylacetamide (PubChem CID 16993433) has the molecular formula C34H41N3O3 and a molecular weight of 539.72 g/mol. Its IUPAC name is N-[5-[1-[4-[2-methoxy-4-[(E)-prop-1-enyl]phenoxy]butyl]benzimidazol-2-yl]pentyl]-2-phenylacetamide.
| Compound Name | N-[5-[1-[4-[2-methoxy-4-[(E)-prop-1-enyl]phenoxy]butyl]benzimidazol-2-yl]pentyl]-2-phenylacetamide |
|---|---|
| PubChem CID | 16993433 |
| Molecular Formula | C34H41N3O3 |
| Molecular Weight | 539.72 g/mol |
| Exact Mass | 539.31 |
| IUPAC Name | N-[5-[1-[4-[2-methoxy-4-[(E)-prop-1-enyl]phenoxy]butyl]benzimidazol-2-yl]pentyl]-2-phenylacetamide |
| SMILES | C/C=C/c1ccc(OCCCCn2c(CCCCCNC(=O)Cc3ccccc3)nc3ccccc32)c(OC)c1 |
| InChI | InChI=1S/C34H41N3O3/c1-3-14-27-20-21-31(32(25-27)39-2)40-24-13-12-23-37-30-18-10-9-17-29(30)36-33(37)19-8-5-11-22-35-34(38)26-28-15-6-4-7-16-28/h3-4,6-7,9-10,14-18,20-21,25H,5,8,11-13,19,22-24,26H2,1-2H3,(H,35,38)/b14-3+ |
| InChIKey | AGQGGJKYWWPPBF-LZWSPWQCSA-N |
| XLogP | 7.01 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.72 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|