C40H45N3O3 — CID 16994404
N-[5-[1-[4-(2-methoxy-4-prop-2-enylphenoxy)butyl]benzimidazol-2-yl]pentyl]-2-(4-phenylphenyl)acetamide (PubChem CID 16994404) has the molecular formula C40H45N3O3 and a molecular weight of 615.82 g/mol. Its IUPAC name is N-[5-[1-[4-(2-methoxy-4-prop-2-enylphenoxy)butyl]benzimidazol-2-yl]pentyl]-2-(4-phenylphenyl)acetamide.
| Compound Name | N-[5-[1-[4-(2-methoxy-4-prop-2-enylphenoxy)butyl]benzimidazol-2-yl]pentyl]-2-(4-phenylphenyl)acetamide |
|---|---|
| PubChem CID | 16994404 |
| Molecular Formula | C40H45N3O3 |
| Molecular Weight | 615.82 g/mol |
| Exact Mass | 615.35 |
| IUPAC Name | N-[5-[1-[4-(2-methoxy-4-prop-2-enylphenoxy)butyl]benzimidazol-2-yl]pentyl]-2-(4-phenylphenyl)acetamide |
| SMILES | C=CCc1ccc(OCCCCn2c(CCCCCNC(=O)Cc3ccc(-c4ccccc4)cc3)nc3ccccc32)c(OC)c1 |
| InChI | InChI=1S/C40H45N3O3/c1-3-14-31-22-25-37(38(29-31)45-2)46-28-13-12-27-43-36-18-10-9-17-35(36)42-39(43)19-8-5-11-26-41-40(44)30-32-20-23-34(24-21-32)33-15-6-4-7-16-33/h3-4,6-7,9-10,15-18,20-25,29H,1,5,8,11-14,19,26-28,30H2,2H3,(H,41,44) |
| InChIKey | ATEHNLGIMDOUPI-UHFFFAOYSA-N |
| XLogP | 8.37 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.82 |
| LogP ≤ 5 | 8.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|